C27H22Cl2N2O5S — CID 16633446
ethyl 4-[(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate (PubChem CID 16633446) has the molecular formula C27H22Cl2N2O5S and a molecular weight of 557.46 g/mol. Its IUPAC name is ethyl 4-[(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 16633446 |
| Molecular Formula | C27H22Cl2N2O5S |
| Molecular Weight | 557.46 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | ethyl 4-[(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCc3ccc(Cl)cc3Cl)c(OC)c2)C(=O)N1c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H22Cl2N2O5S/c1-3-35-26(33)17-6-9-20(10-7-17)31-25(32)24(37-27(31)30)13-16-4-11-22(23(12-16)34-2)36-15-18-5-8-19(28)14-21(18)29/h4-14,30H,3,15H2,1-2H3/b24-13-,30-27- |
| InChIKey | HNDCCPDPSBPOMH-KSXLVSLHSA-N |
| XLogP | 6.81 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.46 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|