C19H15BrN2O4S — CID 16633457
ethyl 4-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate (PubChem CID 16633457) has the molecular formula C19H15BrN2O4S and a molecular weight of 447.31 g/mol. Its IUPAC name is ethyl 4-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 16633457 |
| Molecular Formula | C19H15BrN2O4S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | ethyl 4-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoate |
| SMILES | [H]/N=C1\S/C(=C\c2cc(Br)ccc2O)C(=O)N1c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C19H15BrN2O4S/c1-2-26-18(25)11-3-6-14(7-4-11)22-17(24)16(27-19(22)21)10-12-9-13(20)5-8-15(12)23/h3-10,21,23H,2H2,1H3/b16-10-,21-19- |
| InChIKey | ODEVJFYZGGWISI-STCVOBJUSA-N |
| XLogP | 4.39 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|