C28H40N6O6Si2 — CID 149072607
ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[3-(hydroxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 149072607) has the molecular formula C28H40N6O6Si2 and a molecular weight of 612.84 g/mol. Its IUPAC name is ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[3-(hydroxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[3-(hydroxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 149072607 |
| Molecular Formula | C28H40N6O6Si2 |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[3-(hydroxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(NCCC[Si](C)(O)O[Si](C)(C)C)nc(Nc3ccc(C(=O)OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C28H40N6O6Si2/c1-7-38-24(35)20-10-14-22(15-11-20)30-27-32-26(29-18-9-19-42(6,37)40-41(3,4)5)33-28(34-27)31-23-16-12-21(13-17-23)25(36)39-8-2/h10-17,37H,7-9,18-19H2,1-6H3,(H3,29,30,31,32,33,34) |
| InChIKey | QOHCPUKKFSTZRZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|