C23H29BrN4O4 — CID 44606146
tert-butyl N-[2-[[4-[[4-(3-bromopropoxy)phenyl]diazenyl]benzoyl]amino]ethyl]carbamate (PubChem CID 44606146) has the molecular formula C23H29BrN4O4 and a molecular weight of 505.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[[4-(3-bromopropoxy)phenyl]diazenyl]benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[[4-(3-bromopropoxy)phenyl]diazenyl]benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 44606146 |
| Molecular Formula | C23H29BrN4O4 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | tert-butyl N-[2-[[4-[[4-(3-bromopropoxy)phenyl]diazenyl]benzoyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1ccc(/N=N/c2ccc(OCCCBr)cc2)cc1 |
| InChI | InChI=1S/C23H29BrN4O4/c1-23(2,3)32-22(30)26-15-14-25-21(29)17-5-7-18(8-6-17)27-28-19-9-11-20(12-10-19)31-16-4-13-24/h5-12H,4,13-16H2,1-3H3,(H,25,29)(H,26,30)/b28-27+ |
| InChIKey | RQKKOCBGNHQDNY-BYYHNAKLSA-N |
| XLogP | 5.52 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|