C25H37N5O2 — CID 101128117
N-[2-(2-aminoethylamino)ethyl]-4-[(4-octoxyphenyl)diazenyl]benzamide (PubChem CID 101128117) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)ethyl]-4-[(4-octoxyphenyl)diazenyl]benzamide.
| Compound Name | N-[2-(2-aminoethylamino)ethyl]-4-[(4-octoxyphenyl)diazenyl]benzamide |
|---|---|
| PubChem CID | 101128117 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | N-[2-(2-aminoethylamino)ethyl]-4-[(4-octoxyphenyl)diazenyl]benzamide |
| SMILES | CCCCCCCCOc1ccc(/N=N/c2ccc(C(=O)NCCNCCN)cc2)cc1 |
| InChI | InChI=1S/C25H37N5O2/c1-2-3-4-5-6-7-20-32-24-14-12-23(13-15-24)30-29-22-10-8-21(9-11-22)25(31)28-19-18-27-17-16-26/h8-15,27H,2-7,16-20,26H2,1H3,(H,28,31)/b30-29+ |
| InChIKey | CKARCADUNLUVIV-QVIHXGFCSA-N |
| XLogP | 5.12 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|