C32H35F3IN7O4 — CID 144674535
N-[3-[(2-ethoxy-3-oxocyclobuten-1-yl)amino]-2,2-dimethylpropyl]-4-[[4-[[1-(4-iodophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 144674535) has the molecular formula C32H35F3IN7O4 and a molecular weight of 765.57 g/mol. Its IUPAC name is N-[3-[(2-ethoxy-3-oxocyclobuten-1-yl)amino]-2,2-dimethylpropyl]-4-[[4-[[1-(4-iodophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[3-[(2-ethoxy-3-oxocyclobuten-1-yl)amino]-2,2-dimethylpropyl]-4-[[4-[[1-(4-iodophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 144674535 |
| Molecular Formula | C32H35F3IN7O4 |
| Molecular Weight | 765.57 g/mol |
| Exact Mass | 765.17 |
| IUPAC Name | N-[3-[(2-ethoxy-3-oxocyclobuten-1-yl)amino]-2,2-dimethylpropyl]-4-[[4-[[1-(4-iodophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CCOC1=C(NCC(C)(C)CNC(=O)c2ccc(Nc3nc(NC4(c5ccc(I)cc5)CC4)nc(OCC(F)(F)F)n3)cc2)CC1=O |
| InChI | InChI=1S/C32H35F3IN7O4/c1-4-46-25-23(15-24(25)44)37-16-30(2,3)17-38-26(45)19-5-11-22(12-6-19)39-27-40-28(42-29(41-27)47-18-32(33,34)35)43-31(13-14-31)20-7-9-21(36)10-8-20/h5-12,37H,4,13-18H2,1-3H3,(H,38,45)(H2,39,40,41,42,43) |
| InChIKey | ZUIGVBDOQPQXEC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|