C35H40ClF3N4O5 — CID 159984989
tert-butyl (2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-4,9-dioxononanoate (PubChem CID 159984989) has the molecular formula C35H40ClF3N4O5 and a molecular weight of 689.18 g/mol. Its IUPAC name is tert-butyl (2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-4,9-dioxononanoate.
| Compound Name | tert-butyl (2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-4,9-dioxononanoate |
|---|---|
| PubChem CID | 159984989 |
| Molecular Formula | C35H40ClF3N4O5 |
| Molecular Weight | 689.18 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | tert-butyl (2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-4,9-dioxononanoate |
| SMILES | C[C@@H](CC(=O)CCCCC(=O)c1ccc(Cc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H40ClF3N4O5/c1-22(30(46)48-33(2,3)4)19-27(44)7-5-6-8-28(45)24-11-9-23(10-12-24)20-29-40-31(42-32(41-29)47-21-35(37,38)39)43-34(17-18-34)25-13-15-26(36)16-14-25/h9-16,22H,5-8,17-21H2,1-4H3,(H,40,41,42,43)/t22-/m0/s1 |
| InChIKey | IVGWMURFWNPZBQ-QFIPXVFZSA-N |
| XLogP | 7.84 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.18 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|