C32H36ClF3N4O6S — CID 159556886
1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-6-(2-methoxyethylsulfonyl)-4,4-dimethylhexane-1,5-dione (PubChem CID 159556886) has the molecular formula C32H36ClF3N4O6S and a molecular weight of 697.18 g/mol. Its IUPAC name is 1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-6-(2-methoxyethylsulfonyl)-4,4-dimethylhexane-1,5-dione.
| Compound Name | 1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-6-(2-methoxyethylsulfonyl)-4,4-dimethylhexane-1,5-dione |
|---|---|
| PubChem CID | 159556886 |
| Molecular Formula | C32H36ClF3N4O6S |
| Molecular Weight | 697.18 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | 1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-6-(2-methoxyethylsulfonyl)-4,4-dimethylhexane-1,5-dione |
| SMILES | COCCS(=O)(=O)CC(=O)C(C)(C)CCC(=O)c1ccc(Cc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C32H36ClF3N4O6S/c1-30(2,26(42)19-47(43,44)17-16-45-3)13-12-25(41)22-6-4-21(5-7-22)18-27-37-28(39-29(38-27)46-20-32(34,35)36)40-31(14-15-31)23-8-10-24(33)11-9-23/h4-11H,12-20H2,1-3H3,(H,37,38,39,40) |
| InChIKey | MGCLEBAJITXOOY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.18 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |