C25H25ClF3N5O4S — CID 153035858
2-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-N,N-dimethyl-2-oxoethanesulfonamide (PubChem CID 153035858) has the molecular formula C25H25ClF3N5O4S and a molecular weight of 584.02 g/mol. Its IUPAC name is 2-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-N,N-dimethyl-2-oxoethanesulfonamide.
| Compound Name | 2-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-N,N-dimethyl-2-oxoethanesulfonamide |
|---|---|
| PubChem CID | 153035858 |
| Molecular Formula | C25H25ClF3N5O4S |
| Molecular Weight | 584.02 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 2-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-N,N-dimethyl-2-oxoethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CC(=O)c1ccc(Cc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C25H25ClF3N5O4S/c1-34(2)39(36,37)14-20(35)17-5-3-16(4-6-17)13-21-30-22(32-23(31-21)38-15-25(27,28)29)33-24(11-12-24)18-7-9-19(26)10-8-18/h3-10H,11-15H2,1-2H3,(H,30,31,32,33) |
| InChIKey | VESPHFVABMQLLS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |