C35H40ClF3N4O5S — CID 161040535
1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-4,4-dimethyl-6-(1-propylcyclopropyl)sulfonylhexane-1,5-dione (PubChem CID 161040535) has the molecular formula C35H40ClF3N4O5S and a molecular weight of 721.24 g/mol. Its IUPAC name is 1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-4,4-dimethyl-6-(1-propylcyclopropyl)sulfonylhexane-1,5-dione.
| Compound Name | 1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-4,4-dimethyl-6-(1-propylcyclopropyl)sulfonylhexane-1,5-dione |
|---|---|
| PubChem CID | 161040535 |
| Molecular Formula | C35H40ClF3N4O5S |
| Molecular Weight | 721.24 g/mol |
| Exact Mass | 720.24 |
| IUPAC Name | 1-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-4,4-dimethyl-6-(1-propylcyclopropyl)sulfonylhexane-1,5-dione |
| SMILES | CCCC1(S(=O)(=O)CC(=O)C(C)(C)CCC(=O)c2ccc(Cc3nc(NC4(c5ccc(Cl)cc5)CC4)nc(OCC(F)(F)F)n3)cc2)CC1 |
| InChI | InChI=1S/C35H40ClF3N4O5S/c1-4-14-33(16-17-33)49(46,47)21-28(45)32(2,3)15-13-27(44)24-7-5-23(6-8-24)20-29-40-30(42-31(41-29)48-22-35(37,38)39)43-34(18-19-34)25-9-11-26(36)12-10-25/h5-12H,4,13-22H2,1-3H3,(H,40,41,42,43) |
| InChIKey | UAVAEAMHUACPKB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.24 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |