C32H35ClF3N5O6S — CID 147047022
(2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-N-methylsulfonyl-4,9-dioxononanamide (PubChem CID 147047022) has the molecular formula C32H35ClF3N5O6S and a molecular weight of 710.17 g/mol. Its IUPAC name is (2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-N-methylsulfonyl-4,9-dioxononanamide.
| Compound Name | (2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-N-methylsulfonyl-4,9-dioxononanamide |
|---|---|
| PubChem CID | 147047022 |
| Molecular Formula | C32H35ClF3N5O6S |
| Molecular Weight | 710.17 g/mol |
| Exact Mass | 709.19 |
| IUPAC Name | (2S)-9-[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]phenyl]-2-methyl-N-methylsulfonyl-4,9-dioxononanamide |
| SMILES | C[C@@H](CC(=O)CCCCC(=O)c1ccc(Cc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1)C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C32H35ClF3N5O6S/c1-20(28(44)41-48(2,45)46)17-25(42)5-3-4-6-26(43)22-9-7-21(8-10-22)18-27-37-29(39-30(38-27)47-19-32(34,35)36)40-31(15-16-31)23-11-13-24(33)14-12-23/h7-14,20H,3-6,15-19H2,1-2H3,(H,41,44)(H,37,38,39,40)/t20-/m0/s1 |
| InChIKey | BAOQFWWTMYEDBE-FQEVSTJZSA-N |
| XLogP | 5.57 |
| TPSA | 157.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.17 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|