C22H41N7O5 — CID 67705069
6-[[4-(5-carboxypentylamino)-6-[(2-hydroxyethylamino)-pentylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid (PubChem CID 67705069) has the molecular formula C22H41N7O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is 6-[[4-(5-carboxypentylamino)-6-[(2-hydroxyethylamino)-pentylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid.
| Compound Name | 6-[[4-(5-carboxypentylamino)-6-[(2-hydroxyethylamino)-pentylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 67705069 |
| Molecular Formula | C22H41N7O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | 6-[[4-(5-carboxypentylamino)-6-[(2-hydroxyethylamino)-pentylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid |
| SMILES | CCCCCN(NCCO)c1nc(NCCCCCC(=O)O)nc(NCCCCCC(=O)O)n1 |
| InChI | InChI=1S/C22H41N7O5/c1-2-3-10-16-29(25-15-17-30)22-27-20(23-13-8-4-6-11-18(31)32)26-21(28-22)24-14-9-5-7-12-19(33)34/h25,30H,2-17H2,1H3,(H,31,32)(H,33,34)(H2,23,24,26,27,28) |
| InChIKey | IYYQYQWRZDSOSK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 172.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|