C13H23N5O2 — CID 70560207
2-[[4-(octylamino)-1,3,5-triazin-2-yl]amino]acetic acid (PubChem CID 70560207) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[[4-(octylamino)-1,3,5-triazin-2-yl]amino]acetic acid.
| Compound Name | 2-[[4-(octylamino)-1,3,5-triazin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 70560207 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[[4-(octylamino)-1,3,5-triazin-2-yl]amino]acetic acid |
| SMILES | CCCCCCCCNc1ncnc(NCC(=O)O)n1 |
| InChI | InChI=1S/C13H23N5O2/c1-2-3-4-5-6-7-8-14-12-16-10-17-13(18-12)15-9-11(19)20/h10H,2-9H2,1H3,(H,19,20)(H2,14,15,16,17,18) |
| InChIKey | HKWKZYPLWAHFGS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|