C10H20N6O5 — CID 175331867
N-[4,6-bis(hydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine;hexanoic acid (PubChem CID 175331867) has the molecular formula C10H20N6O5 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[4,6-bis(hydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine;hexanoic acid.
| Compound Name | N-[4,6-bis(hydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine;hexanoic acid |
|---|---|
| PubChem CID | 175331867 |
| Molecular Formula | C10H20N6O5 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[4,6-bis(hydroxyamino)-1,3,5-triazin-2-yl]-N-methylhydroxylamine;hexanoic acid |
| SMILES | CCCCCC(=O)O.CN(O)c1nc(NO)nc(NO)n1 |
| InChI | InChI=1S/C6H12O2.C4H8N6O3/c1-2-3-4-5-6(7)8;1-10(13)4-6-2(8-11)5-3(7-4)9-12/h2-5H2,1H3,(H,7,8);11-13H,1H3,(H2,5,6,7,8,9) |
| InChIKey | UWDXQWUIBPDNMY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|