C35H74N2O2 — CID 157321118
N-decyl-N',N'-diethylpropane-1,3-diamine;octadecanoic acid (PubChem CID 157321118) has the molecular formula C35H74N2O2 and a molecular weight of 554.99 g/mol. Its IUPAC name is N-decyl-N',N'-diethylpropane-1,3-diamine;octadecanoic acid.
| Compound Name | N-decyl-N',N'-diethylpropane-1,3-diamine;octadecanoic acid |
|---|---|
| PubChem CID | 157321118 |
| Molecular Formula | C35H74N2O2 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.58 |
| IUPAC Name | N-decyl-N',N'-diethylpropane-1,3-diamine;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCNCCCN(CC)CC |
| InChI | InChI=1S/C18H36O2.C17H38N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-7-8-9-10-11-12-13-15-18-16-14-17-19(5-2)6-3/h2-17H2,1H3,(H,19,20);18H,4-17H2,1-3H3 |
| InChIKey | BEEFTHISVOKAQQ-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|