C23H34F3N3S — CID 151050201
N-decyl-4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-amine (PubChem CID 151050201) has the molecular formula C23H34F3N3S and a molecular weight of 441.61 g/mol. Its IUPAC name is N-decyl-4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-amine.
| Compound Name | N-decyl-4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 151050201 |
| Molecular Formula | C23H34F3N3S |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-decyl-4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCCCNc1nc(C)c(-c2ccnc(C(C)(C)C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H34F3N3S/c1-5-6-7-8-9-10-11-12-14-28-21-29-17(2)20(30-21)18-13-15-27-19(16-18)22(3,4)23(24,25)26/h13,15-16H,5-12,14H2,1-4H3,(H,28,29) |
| InChIKey | MDYQQNFZVZSCMF-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|