C25H26F4N6O4S2 — CID 168872901
(2S,4R)-4-[(2-fluorophenyl)sulfonylamino]-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide (PubChem CID 168872901) has the molecular formula C25H26F4N6O4S2 and a molecular weight of 614.65 g/mol. Its IUPAC name is (2S,4R)-4-[(2-fluorophenyl)sulfonylamino]-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S,4R)-4-[(2-fluorophenyl)sulfonylamino]-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 168872901 |
| Molecular Formula | C25H26F4N6O4S2 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | (2S,4R)-4-[(2-fluorophenyl)sulfonylamino]-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1nc(NC(=O)N2C[C@H](NS(=O)(=O)c3ccccc3F)C[C@H]2C(N)=O)sc1-c1ccnc(C(C)(C)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F4N6O4S2/c1-13-20(14-8-9-31-19(10-14)24(2,3)25(27,28)29)40-22(32-13)33-23(37)35-12-15(11-17(35)21(30)36)34-41(38,39)18-7-5-4-6-16(18)26/h4-10,15,17,34H,11-12H2,1-3H3,(H2,30,36)(H,32,33,37)/t15-,17+/m1/s1 |
| InChIKey | RXPMELCQAKKERJ-WBVHZDCISA-N |
| XLogP | 3.93 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |