C14H11F2N3 — CID 62615257
2-[2-(3,5-difluorophenyl)ethylamino]pyridine-4-carbonitrile (PubChem CID 62615257) has the molecular formula C14H11F2N3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethylamino]pyridine-4-carbonitrile.
| Compound Name | 2-[2-(3,5-difluorophenyl)ethylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 62615257 |
| Molecular Formula | C14H11F2N3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethylamino]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NCCc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C14H11F2N3/c15-12-5-10(6-13(16)8-12)1-3-18-14-7-11(9-17)2-4-19-14/h2,4-8H,1,3H2,(H,18,19) |
| InChIKey | HCKUZCMPUPODPJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |