C12H17N3 — CID 61039208
2-(4-methylpentylamino)pyridine-4-carbonitrile (PubChem CID 61039208) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-(4-methylpentylamino)pyridine-4-carbonitrile.
| Compound Name | 2-(4-methylpentylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 61039208 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-(4-methylpentylamino)pyridine-4-carbonitrile |
| SMILES | CC(C)CCCNc1cc(C#N)ccn1 |
| InChI | InChI=1S/C12H17N3/c1-10(2)4-3-6-14-12-8-11(9-13)5-7-15-12/h5,7-8,10H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | OHSNUHNWAOBZET-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|