C11H16N4 — CID 115302962
2-[[2-methyl-3-(methylamino)propyl]amino]pyridine-4-carbonitrile (PubChem CID 115302962) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-[[2-methyl-3-(methylamino)propyl]amino]pyridine-4-carbonitrile.
| Compound Name | 2-[[2-methyl-3-(methylamino)propyl]amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 115302962 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-[[2-methyl-3-(methylamino)propyl]amino]pyridine-4-carbonitrile |
| SMILES | CNCC(C)CNc1cc(C#N)ccn1 |
| InChI | InChI=1S/C11H16N4/c1-9(7-13-2)8-15-11-5-10(6-12)3-4-14-11/h3-5,9,13H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | IGKBJPXTAMFUFX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |