C10H15N5 — CID 107552672
2-[[2-methyl-3-(methylamino)propyl]amino]pyrimidine-4-carbonitrile (PubChem CID 107552672) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[[2-methyl-3-(methylamino)propyl]amino]pyrimidine-4-carbonitrile.
| Compound Name | 2-[[2-methyl-3-(methylamino)propyl]amino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107552672 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-[[2-methyl-3-(methylamino)propyl]amino]pyrimidine-4-carbonitrile |
| SMILES | CNCC(C)CNc1nccc(C#N)n1 |
| InChI | InChI=1S/C10H15N5/c1-8(6-12-2)7-14-10-13-4-3-9(5-11)15-10/h3-4,8,12H,6-7H2,1-2H3,(H,13,14,15) |
| InChIKey | BYPXRIFQZZNMCP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |