C10H12N4O3 — CID 107543201
4-[(4-cyanopyrimidin-2-yl)amino]-3-methoxybutanoic acid (PubChem CID 107543201) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4-[(4-cyanopyrimidin-2-yl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(4-cyanopyrimidin-2-yl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 107543201 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 4-[(4-cyanopyrimidin-2-yl)amino]-3-methoxybutanoic acid |
| SMILES | COC(CNc1nccc(C#N)n1)CC(=O)O |
| InChI | InChI=1S/C10H12N4O3/c1-17-8(4-9(15)16)6-13-10-12-3-2-7(5-11)14-10/h2-3,8H,4,6H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | ZPUKITURNRWCPP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |