C9H10N4O2 — CID 167798650
(2S)-2-[(4-cyanopyrimidin-2-yl)amino]butanoic acid (PubChem CID 167798650) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2S)-2-[(4-cyanopyrimidin-2-yl)amino]butanoic acid.
| Compound Name | (2S)-2-[(4-cyanopyrimidin-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 167798650 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (2S)-2-[(4-cyanopyrimidin-2-yl)amino]butanoic acid |
| SMILES | CC[C@H](Nc1nccc(C#N)n1)C(=O)O |
| InChI | InChI=1S/C9H10N4O2/c1-2-7(8(14)15)13-9-11-4-3-6(5-10)12-9/h3-4,7H,2H2,1H3,(H,14,15)(H,11,12,13)/t7-/m0/s1 |
| InChIKey | GHLCYNHUMYSIPW-ZETCQYMHSA-N |
| XLogP | 0.62 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |