C10H14N4O — CID 107545092
2-(4-hydroxypentan-2-ylamino)pyrimidine-4-carbonitrile (PubChem CID 107545092) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(4-hydroxypentan-2-ylamino)pyrimidine-4-carbonitrile.
| Compound Name | 2-(4-hydroxypentan-2-ylamino)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545092 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(4-hydroxypentan-2-ylamino)pyrimidine-4-carbonitrile |
| SMILES | CC(O)CC(C)Nc1nccc(C#N)n1 |
| InChI | InChI=1S/C10H14N4O/c1-7(5-8(2)15)13-10-12-4-3-9(6-11)14-10/h3-4,7-8,15H,5H2,1-2H3,(H,12,13,14) |
| InChIKey | RETQXGWATBDWRM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |