C11H8N4O3 — CID 107543095
5-[[(4-cyanopyrimidin-2-yl)amino]methyl]furan-2-carboxylic acid (PubChem CID 107543095) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 5-[[(4-cyanopyrimidin-2-yl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(4-cyanopyrimidin-2-yl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107543095 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 5-[[(4-cyanopyrimidin-2-yl)amino]methyl]furan-2-carboxylic acid |
| SMILES | N#Cc1ccnc(NCc2ccc(C(=O)O)o2)n1 |
| InChI | InChI=1S/C11H8N4O3/c12-5-7-3-4-13-11(15-7)14-6-8-1-2-9(18-8)10(16)17/h1-4H,6H2,(H,16,17)(H,13,14,15) |
| InChIKey | JBJHXLYUTRQBKM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |