C11H16N4O — CID 106158675
2-[(5-hydroxy-4-methylpentyl)amino]pyrimidine-4-carbonitrile (PubChem CID 106158675) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-[(5-hydroxy-4-methylpentyl)amino]pyrimidine-4-carbonitrile.
| Compound Name | 2-[(5-hydroxy-4-methylpentyl)amino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 106158675 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-[(5-hydroxy-4-methylpentyl)amino]pyrimidine-4-carbonitrile |
| SMILES | CC(CO)CCCNc1nccc(C#N)n1 |
| InChI | InChI=1S/C11H16N4O/c1-9(8-16)3-2-5-13-11-14-6-4-10(7-12)15-11/h4,6,9,16H,2-3,5,8H2,1H3,(H,13,14,15) |
| InChIKey | XIGPYTLCFHTIRP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|