C11H11N3 — CID 116644253
2-(pent-3-ynylamino)pyridine-4-carbonitrile (PubChem CID 116644253) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-(pent-3-ynylamino)pyridine-4-carbonitrile.
| Compound Name | 2-(pent-3-ynylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 116644253 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(pent-3-ynylamino)pyridine-4-carbonitrile |
| SMILES | CC#CCCNc1cc(C#N)ccn1 |
| InChI | InChI=1S/C11H11N3/c1-2-3-4-6-13-11-8-10(9-12)5-7-14-11/h5,7-8H,4,6H2,1H3,(H,13,14) |
| InChIKey | DWXOKFSXRMZFAB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|