C12H10F3N3 — CID 113305702
N-[2-(3,5-difluorophenyl)ethyl]-6-fluoropyrimidin-4-amine (PubChem CID 113305702) has the molecular formula C12H10F3N3 and a molecular weight of 253.23 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-6-fluoropyrimidin-4-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-6-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 113305702 |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-6-fluoropyrimidin-4-amine |
| SMILES | Fc1cc(F)cc(CCNc2cc(F)ncn2)c1 |
| InChI | InChI=1S/C12H10F3N3/c13-9-3-8(4-10(14)5-9)1-2-16-12-6-11(15)17-7-18-12/h3-7H,1-2H2,(H,16,17,18) |
| InChIKey | GNTXNUANHWVVJK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |