C11H11F2N3 — CID 106570305
N-[2-(3,5-difluorophenyl)ethyl]-1H-imidazol-2-amine (PubChem CID 106570305) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-1H-imidazol-2-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106570305 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-1H-imidazol-2-amine |
| SMILES | Fc1cc(F)cc(CCNc2ncc[nH]2)c1 |
| InChI | InChI=1S/C11H11F2N3/c12-9-5-8(6-10(13)7-9)1-2-14-11-15-3-4-16-11/h3-7H,1-2H2,(H2,14,15,16) |
| InChIKey | HDUPZIYYEYGGOX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |