C15H17F2N3 — CID 62614721
N-[2-(3,5-difluorophenyl)ethyl]-6-propan-2-ylpyrimidin-4-amine (PubChem CID 62614721) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62614721 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1cc(NCCc2cc(F)cc(F)c2)ncn1 |
| InChI | InChI=1S/C15H17F2N3/c1-10(2)14-8-15(20-9-19-14)18-4-3-11-5-12(16)7-13(17)6-11/h5-10H,3-4H2,1-2H3,(H,18,19,20) |
| InChIKey | LQOBTNQXJQQZFM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |