About N-(cyclopropylmethyl)-2,3-difluoroaniline
N-(cyclopropylmethyl)-2,3-difluoroaniline (PubChem CID 61076617) has the molecular formula C10H11F2N
and a molecular weight of 183.20 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,3-difluoroaniline.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-2,3-difluoroaniline |
| PubChem CID | 61076617 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-(cyclopropylmethyl)-2,3-difluoroaniline |
| SMILES | Fc1cccc(NCC2CC2)c1F |
| InChI | InChI=1S/C10H11F2N/c11-8-2-1-3-9(10(8)12)13-6-7-4-5-7/h1-3,7,13H,4-6H2 |
| InChIKey | NXPACNQUIMYPMY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclopropylmethyl)-2,3-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-2,3-difluoroaniline?
The IUPAC name of N-(cyclopropylmethyl)-2,3-difluoroaniline (CID 61076617) is N-(cyclopropylmethyl)-2,3-difluoroaniline.
What is the SMILES notation for N-(cyclopropylmethyl)-2,3-difluoroaniline?
The canonical SMILES for N-(cyclopropylmethyl)-2,3-difluoroaniline is Fc1cccc(NCC2CC2)c1F.
What is the InChIKey of N-(cyclopropylmethyl)-2,3-difluoroaniline?
The InChIKey is NXPACNQUIMYPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N/c11-8-2-1-3-9(10(8)12)13-6-7-4-5-7/h1-3,7,13H,4-6H2.
What are the key properties of N-(cyclopropylmethyl)-2,3-difluoroaniline?
N-(cyclopropylmethyl)-2,3-difluoroaniline has a molecular weight of 183.20 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-2,3-difluoroaniline is sourced from PubChem (CID 61076617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).