About N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline (PubChem CID 103276631) has the molecular formula C15H19F2N
and a molecular weight of 251.32 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline.
Molecular Properties
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline |
| PubChem CID | 103276631 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline |
| SMILES | CC1=CC(C)CC(CNc2cccc(F)c2F)C1 |
| InChI | InChI=1S/C15H19F2N/c1-10-6-11(2)8-12(7-10)9-18-14-5-3-4-13(16)15(14)17/h3-6,10,12,18H,7-9H2,1-2H3 |
| InChIKey | SOKZONJTUXAOAB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline?
The IUPAC name of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline (CID 103276631) is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline.
What is the SMILES notation for N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline?
The canonical SMILES for N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline is CC1=CC(C)CC(CNc2cccc(F)c2F)C1.
What is the InChIKey of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline?
The InChIKey is SOKZONJTUXAOAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2N/c1-10-6-11(2)8-12(7-10)9-18-14-5-3-4-13(16)15(14)17/h3-6,10,12,18H,7-9H2,1-2H3.
What are the key properties of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline?
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline has a molecular weight of 251.32 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,3-difluoroaniline is sourced from PubChem (CID 103276631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).