C18H27N — CID 103275978
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-propan-2-ylaniline (PubChem CID 103275978) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-propan-2-ylaniline.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-propan-2-ylaniline |
|---|---|
| PubChem CID | 103275978 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-propan-2-ylaniline |
| SMILES | CC1=CC(C)CC(CNc2ccccc2C(C)C)C1 |
| InChI | InChI=1S/C18H27N/c1-13(2)17-7-5-6-8-18(17)19-12-16-10-14(3)9-15(4)11-16/h5-9,13-14,16,19H,10-12H2,1-4H3 |
| InChIKey | DJOVMWIHRZEFCO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|