C16H22ClN — CID 103275965
3-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methylaniline (PubChem CID 103275965) has the molecular formula C16H22ClN and a molecular weight of 263.81 g/mol. Its IUPAC name is 3-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methylaniline.
| Compound Name | 3-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 103275965 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methylaniline |
| SMILES | CC1=CC(C)CC(CNc2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C16H22ClN/c1-11-7-12(2)9-14(8-11)10-18-16-6-4-5-15(17)13(16)3/h4-7,11,14,18H,8-10H2,1-3H3 |
| InChIKey | PVMWMTDSCLCZDB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|