About 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline
5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline (PubChem CID 103276003) has the molecular formula C16H22ClNO
and a molecular weight of 279.81 g/mol. Its IUPAC name is 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline.
Molecular Properties
| Compound Name | 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline |
| PubChem CID | 103276003 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline |
| SMILES | COc1ccc(Cl)cc1NCC1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C16H22ClNO/c1-11-6-12(2)8-13(7-11)10-18-15-9-14(17)4-5-16(15)19-3/h4-6,9,11,13,18H,7-8,10H2,1-3H3 |
| InChIKey | KJDXJPWCSJEHAO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline?
The IUPAC name of 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline (CID 103276003) is 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline.
What is the SMILES notation for 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline?
The canonical SMILES for 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline is COc1ccc(Cl)cc1NCC1CC(C)=CC(C)C1.
What is the InChIKey of 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline?
The InChIKey is KJDXJPWCSJEHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClNO/c1-11-6-12(2)8-13(7-11)10-18-15-9-14(17)4-5-16(15)19-3/h4-6,9,11,13,18H,7-8,10H2,1-3H3.
What are the key properties of 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline?
5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline has a molecular weight of 279.81 g/mol, XLogP of 4.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxyaniline is sourced from PubChem (CID 103276003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).