C15H19Br2N — CID 103276449
2,5-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline (PubChem CID 103276449) has the molecular formula C15H19Br2N and a molecular weight of 373.13 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline.
| Compound Name | 2,5-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 103276449 |
| Molecular Formula | C15H19Br2N |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2,5-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline |
| SMILES | CC1=CC(C)CC(CNc2cc(Br)ccc2Br)C1 |
| InChI | InChI=1S/C15H19Br2N/c1-10-5-11(2)7-12(6-10)9-18-15-8-13(16)3-4-14(15)17/h3-5,8,10,12,18H,6-7,9H2,1-2H3 |
| InChIKey | VFXWWBCVRZWMLW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|