About 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline
2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline (PubChem CID 103276270) has the molecular formula C15H19Br2N
and a molecular weight of 373.13 g/mol. Its IUPAC name is 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline.
Molecular Properties
| Compound Name | 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline |
| PubChem CID | 103276270 |
| Molecular Formula | C15H19Br2N |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline |
| SMILES | CC1=CC(C)CC(CNc2ccc(Br)cc2Br)C1 |
| InChI | InChI=1S/C15H19Br2N/c1-10-5-11(2)7-12(6-10)9-18-15-4-3-13(16)8-14(15)17/h3-5,8,10,12,18H,6-7,9H2,1-2H3 |
| InChIKey | MHCGFQAVDBLIJX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline?
The IUPAC name of 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline (CID 103276270) is 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline.
What is the SMILES notation for 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline?
The canonical SMILES for 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline is CC1=CC(C)CC(CNc2ccc(Br)cc2Br)C1.
What is the InChIKey of 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline?
The InChIKey is MHCGFQAVDBLIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Br2N/c1-10-5-11(2)7-12(6-10)9-18-15-4-3-13(16)8-14(15)17/h3-5,8,10,12,18H,6-7,9H2,1-2H3.
What are the key properties of 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline?
2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline has a molecular weight of 373.13 g/mol, XLogP of 5.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline is sourced from PubChem (CID 103276270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).