C14H25N — CID 103276186
1-cyclobutyl-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]methanamine (PubChem CID 103276186) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-cyclobutyl-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]methanamine.
| Compound Name | 1-cyclobutyl-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]methanamine |
|---|---|
| PubChem CID | 103276186 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-cyclobutyl-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]methanamine |
| SMILES | CC1=CC(C)CC(CNCC2CCC2)C1 |
| InChI | InChI=1S/C14H25N/c1-11-6-12(2)8-14(7-11)10-15-9-13-4-3-5-13/h6,11,13-15H,3-5,7-10H2,1-2H3 |
| InChIKey | HWPWKPZTQYESLF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|