C12H20BrN — CID 103277074
2-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]prop-2-en-1-amine (PubChem CID 103277074) has the molecular formula C12H20BrN and a molecular weight of 258.20 g/mol. Its IUPAC name is 2-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]prop-2-en-1-amine.
| Compound Name | 2-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103277074 |
| Molecular Formula | C12H20BrN |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]prop-2-en-1-amine |
| SMILES | C=C(Br)CNCC1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C12H20BrN/c1-9-4-10(2)6-12(5-9)8-14-7-11(3)13/h4,9,12,14H,3,5-8H2,1-2H3 |
| InChIKey | FSBIWOPNZQPAGN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|