C13H23NO2 — CID 103276524
ethyl 2-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]acetate (PubChem CID 103276524) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is ethyl 2-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]acetate.
| Compound Name | ethyl 2-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]acetate |
|---|---|
| PubChem CID | 103276524 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethyl 2-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]acetate |
| SMILES | CCOC(=O)CNCC1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C13H23NO2/c1-4-16-13(15)9-14-8-12-6-10(2)5-11(3)7-12/h5,10,12,14H,4,6-9H2,1-3H3 |
| InChIKey | ZYWAUUKDKUSGEW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|