C17H22N2 — CID 103276099
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indol-5-amine (PubChem CID 103276099) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indol-5-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 103276099 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indol-5-amine |
| SMILES | CC1=CC(C)CC(CNc2ccc3[nH]ccc3c2)C1 |
| InChI | InChI=1S/C17H22N2/c1-12-7-13(2)9-14(8-12)11-19-16-3-4-17-15(10-16)5-6-18-17/h3-7,10,12,14,18-19H,8-9,11H2,1-2H3 |
| InChIKey | OEHBMIDIKZFVRM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|