C16H20F3N — CID 103275963
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(trifluoromethyl)aniline (PubChem CID 103275963) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 103275963 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(trifluoromethyl)aniline |
| SMILES | CC1=CC(C)CC(CNc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H20F3N/c1-11-6-12(2)8-13(7-11)10-20-15-5-3-4-14(9-15)16(17,18)19/h3-6,9,11,13,20H,7-8,10H2,1-2H3 |
| InChIKey | GTZIESXOFRJHJX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|