C16H19F4N — CID 103276646
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline (PubChem CID 103276646) has the molecular formula C16H19F4N and a molecular weight of 301.33 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 103276646 |
| Molecular Formula | C16H19F4N |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline |
| SMILES | CC1=CC(C)CC(CNc2ccc(F)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H19F4N/c1-10-5-11(2)7-12(6-10)9-21-13-3-4-15(17)14(8-13)16(18,19)20/h3-5,8,10,12,21H,6-7,9H2,1-2H3 |
| InChIKey | IWUSKULWXMSJPM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|