C15H19BrIN — CID 114259615
4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline (PubChem CID 114259615) has the molecular formula C15H19BrIN and a molecular weight of 420.13 g/mol. Its IUPAC name is 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline.
| Compound Name | 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline |
|---|---|
| PubChem CID | 114259615 |
| Molecular Formula | C15H19BrIN |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline |
| SMILES | CC1=CC(C)CC(CNc2ccc(Br)c(I)c2)C1 |
| InChI | InChI=1S/C15H19BrIN/c1-10-5-11(2)7-12(6-10)9-18-13-3-4-14(16)15(17)8-13/h3-5,8,10,12,18H,6-7,9H2,1-2H3 |
| InChIKey | LUJHURBZSBSRLF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|