About 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline
4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline (PubChem CID 114259615) has the molecular formula C15H19BrIN
and a molecular weight of 420.13 g/mol. Its IUPAC name is 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline.
Molecular Properties
| Compound Name | 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline |
| PubChem CID | 114259615 |
| Molecular Formula | C15H19BrIN |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline |
| SMILES | CC1=CC(C)CC(CNc2ccc(Br)c(I)c2)C1 |
| InChI | InChI=1S/C15H19BrIN/c1-10-5-11(2)7-12(6-10)9-18-13-3-4-14(16)15(17)8-13/h3-5,8,10,12,18H,6-7,9H2,1-2H3 |
| InChIKey | LUJHURBZSBSRLF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline?
The IUPAC name of 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline (CID 114259615) is 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline.
What is the SMILES notation for 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline?
The canonical SMILES for 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline is CC1=CC(C)CC(CNc2ccc(Br)c(I)c2)C1.
What is the InChIKey of 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline?
The InChIKey is LUJHURBZSBSRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrIN/c1-10-5-11(2)7-12(6-10)9-18-13-3-4-14(16)15(17)8-13/h3-5,8,10,12,18H,6-7,9H2,1-2H3.
What are the key properties of 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline?
4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline has a molecular weight of 420.13 g/mol, XLogP of 5.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-iodoaniline is sourced from PubChem (CID 114259615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).