C16H21N3 — CID 103276309
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indazol-5-amine (PubChem CID 103276309) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indazol-5-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 103276309 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1H-indazol-5-amine |
| SMILES | CC1=CC(C)CC(CNc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C16H21N3/c1-11-5-12(2)7-13(6-11)9-17-15-3-4-16-14(8-15)10-18-19-16/h3-5,8,10-11,13,17H,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | ZPKPGHUGNLAARK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|