C16H22N2O3 — CID 103276360
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxy-5-nitroaniline (PubChem CID 103276360) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxy-5-nitroaniline.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxy-5-nitroaniline |
|---|---|
| PubChem CID | 103276360 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-methoxy-5-nitroaniline |
| SMILES | COc1ccc([N+](=O)[O-])cc1NCC1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-6-12(2)8-13(7-11)10-17-15-9-14(18(19)20)4-5-16(15)21-3/h4-6,9,11,13,17H,7-8,10H2,1-3H3 |
| InChIKey | FEHIDOKBVGVFGP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|