C17H24F3N — CID 104575070
N-[(4-tert-butylcyclohexyl)methyl]-2,3,5-trifluoroaniline (PubChem CID 104575070) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexyl)methyl]-2,3,5-trifluoroaniline.
| Compound Name | N-[(4-tert-butylcyclohexyl)methyl]-2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 104575070 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N-[(4-tert-butylcyclohexyl)methyl]-2,3,5-trifluoroaniline |
| SMILES | CC(C)(C)C1CCC(CNc2cc(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C17H24F3N/c1-17(2,3)12-6-4-11(5-7-12)10-21-15-9-13(18)8-14(19)16(15)20/h8-9,11-12,21H,4-7,10H2,1-3H3 |
| InChIKey | RJEGMIRJLPZUGF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|