C23H33F3 — CID 163900040
5-[4-[(4-tert-butylcyclohexyl)methyl]cyclohexyl]-1,2,3-trifluorobenzene (PubChem CID 163900040) has the molecular formula C23H33F3 and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-[4-[(4-tert-butylcyclohexyl)methyl]cyclohexyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[(4-tert-butylcyclohexyl)methyl]cyclohexyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 163900040 |
| Molecular Formula | C23H33F3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 5-[4-[(4-tert-butylcyclohexyl)methyl]cyclohexyl]-1,2,3-trifluorobenzene |
| SMILES | CC(C)(C)C1CCC(CC2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H33F3/c1-23(2,3)19-10-6-16(7-11-19)12-15-4-8-17(9-5-15)18-13-20(24)22(26)21(25)14-18/h13-17,19H,4-12H2,1-3H3 |
| InChIKey | QIZUHBFOTOIQIF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|