About 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene
4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene (PubChem CID 144902495) has the molecular formula C16H22F2
and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene |
| PubChem CID | 144902495 |
| Molecular Formula | C16H22F2 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene |
| SMILES | CC(C)(C)C1CCC(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H22F2/c1-16(2,3)13-7-4-11(5-8-13)12-6-9-14(17)15(18)10-12/h6,9-11,13H,4-5,7-8H2,1-3H3 |
| InChIKey | QNGNBRAHKVVCPG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene?
The IUPAC name of 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene (CID 144902495) is 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene.
What is the SMILES notation for 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene?
The canonical SMILES for 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene is CC(C)(C)C1CCC(c2ccc(F)c(F)c2)CC1.
What is the InChIKey of 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene?
The InChIKey is QNGNBRAHKVVCPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2/c1-16(2,3)13-7-4-11(5-8-13)12-6-9-14(17)15(18)10-12/h6,9-11,13H,4-5,7-8H2,1-3H3.
What are the key properties of 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene?
4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene has a molecular weight of 252.35 g/mol, XLogP of 5.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-tert-butylcyclohexyl)-1,2-difluorobenzene is sourced from PubChem (CID 144902495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).