C21H40 — CID 59934768
1-tert-butyl-4-[(4-tert-butylcyclohexyl)methyl]cyclohexane (PubChem CID 59934768) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 1-tert-butyl-4-[(4-tert-butylcyclohexyl)methyl]cyclohexane.
| Compound Name | 1-tert-butyl-4-[(4-tert-butylcyclohexyl)methyl]cyclohexane |
|---|---|
| PubChem CID | 59934768 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 1-tert-butyl-4-[(4-tert-butylcyclohexyl)methyl]cyclohexane |
| SMILES | CC(C)(C)C1CCC(CC2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C21H40/c1-20(2,3)18-11-7-16(8-12-18)15-17-9-13-19(14-10-17)21(4,5)6/h16-19H,7-15H2,1-6H3 |
| InChIKey | NKPNEOFNPNULAI-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |